Products 1014689-18-9
CAS 1014689-18-9 appears in our catalog under these names: Sudan 4 D6 (naphthyl D6), Sudan 4 D6 (naphthyl D6) 100 µg/mL in Acetone, Sudan IV-d6, >95% (HPLC), Sudan IV-d6, Sudan-IV-D6, oekanal. Offered by: Dr. Ehrenstorfer, TRC, MedChemExpress, Sigma-Aldrich, HPC Standards. Available pack sizes: 10mg, 1ml, 5mg, 5 mg.
(1E)-3,4,5,6,7,8-hexadeuterio-1-[[2-methyl-4-[(2-methylphenyl)diazenyl]phenyl]hydrazinylidene]naphthalen-2-one (CAS 1014689-18-9) is a chemical compound with the molecular formula C24H20N4O and a molecular weight of 386.5 g/mol. IUPAC name: (1E)-3,4,5,6,7,8-hexadeuterio-1-[[2-methyl-4-[(2-methylphenyl)diazenyl]phenyl]hydrazinylidene]naphthalen-2-one. InChIKey: KMDLOETUWUPGMB-HKFNDDFESA-N.
| Molecular formula | C24H20N4O |
|---|---|
| Molecular weight | 386.5 g/mol |
| IUPAC name | (1E)-3,4,5,6,7,8-hexadeuterio-1-[[2-methyl-4-[(2-methylphenyl)diazenyl]phenyl]hydrazinylidene]naphthalen-2-one |
| InChIKey | KMDLOETUWUPGMB-HKFNDDFESA-N |
| SMILES | [2H]C1=C(C(=C\2C(=C1[2H])C(=C(C(=O)/C2=N/NC3=C(C=C(C=C3)N=NC4=CC=CC=C4C)C)[2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)
Synonyms:
Sudan IV-d6, analytical standard