CAS 101477-54-7 appears in our catalog under these names: Lomerizine Dihydrochloride, >95% (HPLC), Lomerizine HCl, Lomerizine dihydrochloride/ 99.87% (existing batch purity), Lomerizine dihydrochloride, Lomerizine Dihydrochloride, >98.0%(HPLC)(T). Offered by: TRC, GLPBio, TargetMol, Biosynth, TCI. Available pack sizes: 10mg, 250mg, 500mg, 100mg, 50mg, 25mg, 200mg, 1000mg.
1-[bis(4-fluorophenyl)methyl]-4-[(2,3,4-trimethoxyphenyl)methyl]piperazine;dihydrochloride (CAS 101477-54-7) is a chemical compound with the molecular formula C27H32Cl2F2N2O3 and a molecular weight of 541.5 g/mol. IUPAC name: 1-[bis(4-fluorophenyl)methyl]-4-[(2,3,4-trimethoxyphenyl)methyl]piperazine;dihydrochloride. InChIKey: LOGVKVSFYBBUAJ-UHFFFAOYSA-N.
| Molecular formula | C27H32Cl2F2N2O3 |
|---|---|
| Molecular weight | 541.5 g/mol |
| IUPAC name | 1-[bis(4-fluorophenyl)methyl]-4-[(2,3,4-trimethoxyphenyl)methyl]piperazine;dihydrochloride |
| InChIKey | LOGVKVSFYBBUAJ-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)CN2CCN(CC2)C(C3=CC=C(C=C3)F)C4=CC=C(C=C4)F)OC)OC.Cl.Cl |
Computed by PubChem (NCBI)