CAS 101479-37-2 is the registry number for N2,N2-Diethyl-9H-purine-2,6-diamine, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2-N,2-N-diethyl-7H-purine-2,6-diamine (CAS 101479-37-2) is a chemical compound with the molecular formula C9H14N6 and a molecular weight of 206.25 g/mol. IUPAC name: 2-N,2-N-diethyl-7H-purine-2,6-diamine. InChIKey: DKCQTGRLZTUGMM-UHFFFAOYSA-N.
| Molecular formula | C9H14N6 |
|---|---|
| Molecular weight | 206.25 g/mol |
| IUPAC name | 2-N,2-N-diethyl-7H-purine-2,6-diamine |
| InChIKey | DKCQTGRLZTUGMM-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=NC(=C2C(=N1)N=CN2)N |
Computed by PubChem (NCBI)