CAS 101495-45-8 appears in our catalog under these names: 5-Bromo-2-hydroxybenzene-1,3-dicarboxylic acid, 98%, 5-Bromo-2-hydroxyisophthalic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 1g, 250mg.
5-bromo-2-hydroxybenzene-1,3-dicarboxylic acid (CAS 101495-45-8) is a chemical compound with the molecular formula C8H5BrO5 and a molecular weight of 261.03 g/mol. IUPAC name: 5-bromo-2-hydroxybenzene-1,3-dicarboxylic acid. InChIKey: QQTLVPYLDMZFOX-UHFFFAOYSA-N.
| Molecular formula | C8H5BrO5 |
|---|---|
| Molecular weight | 261.03 g/mol |
| IUPAC name | 5-bromo-2-hydroxybenzene-1,3-dicarboxylic acid |
| InChIKey | QQTLVPYLDMZFOX-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)O)C(=O)O)Br |
Computed by PubChem (NCBI)