Products 1015073-44-5
CAS 1015073-44-5 is the registry number for PSI-7410. Offered by: MedChemExpress. Available pack sizes: Get quote.
[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methyl phosphono hydrogen phosphate (CAS 1015073-44-5) is a chemical compound with the molecular formula C10H15FN2O11P2 and a molecular weight of 420.18 g/mol. IUPAC name: [(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methyl phosphono hydrogen phosphate. InChIKey: VPPLCOBQDZAMRD-VPCXQMTMSA-N.
| Molecular formula | C10H15FN2O11P2 |
|---|---|
| Molecular weight | 420.18 g/mol |
| IUPAC name | [(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methyl phosphono hydrogen phosphate |
| InChIKey | VPPLCOBQDZAMRD-VPCXQMTMSA-N |
| SMILES | C[C@]1([C@@H]([C@H](O[C@H]1N2C=CC(=O)NC2=O)COP(=O)(O)OP(=O)(O)O)O)F |
Computed by PubChem (NCBI)