CAS 1015411-22-9 is the registry number for 9-Ethyl-3,6-di(1H-pyrazol-1-yl)-9H-carbazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
9-ethyl-3,6-di(pyrazol-1-yl)carbazole (CAS 1015411-22-9) is a chemical compound with the molecular formula C20H17N5 and a molecular weight of 327.4 g/mol. IUPAC name: 9-ethyl-3,6-di(pyrazol-1-yl)carbazole. InChIKey: GGIJEXNBTSTRPF-UHFFFAOYSA-N.
| Molecular formula | C20H17N5 |
|---|---|
| Molecular weight | 327.4 g/mol |
| IUPAC name | 9-ethyl-3,6-di(pyrazol-1-yl)carbazole |
| InChIKey | GGIJEXNBTSTRPF-UHFFFAOYSA-N |
| SMILES | CCN1C2=C(C=C(C=C2)N3C=CC=N3)C4=C1C=CC(=C4)N5C=CC=N5 |
Computed by PubChem (NCBI)