CAS 1015447-26-3 appears in our catalog under these names: 1-O-Acetyl-2,3,5-tri-O-benzoyl-4-thio-b-D-ribofuranose, (3R,4S,5R)-2-Acetoxy-5-((benzoyloxy)methyl)tetrahydrothiophene-3,4-diyl dibenzoate, 95%, 95%. Offered by: Biosynth, Chemat. Available pack sizes: 1g, 5g, 10g, 25g.
[(2R,3S,4R)-5-acetyloxy-3,4-dibenzoyloxythiolan-2-yl]methyl benzoate (CAS 1015447-26-3) is a chemical compound with the molecular formula C28H24O8S and a molecular weight of 520.6 g/mol. IUPAC name: [(2R,3S,4R)-5-acetyloxy-3,4-dibenzoyloxythiolan-2-yl]methyl benzoate. InChIKey: ACUZOAXNZDOSKC-ASAMFVBJSA-N.
| Molecular formula | C28H24O8S |
|---|---|
| Molecular weight | 520.6 g/mol |
| IUPAC name | [(2R,3S,4R)-5-acetyloxy-3,4-dibenzoyloxythiolan-2-yl]methyl benzoate |
| InChIKey | ACUZOAXNZDOSKC-ASAMFVBJSA-N |
| SMILES | CC(=O)OC1[C@@H]([C@@H]([C@H](S1)COC(=O)C2=CC=CC=C2)OC(=O)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)