CAS 1015609-83-2 is the registry number for 4-Chloro-5-iodo-1-(triisopropylsilyl)-1h-pyrrolo[2,3-b]pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(4-chloro-5-iodopyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)silane (CAS 1015609-83-2) is a chemical compound with the molecular formula C16H24ClIN2Si and a molecular weight of 434.82 g/mol. IUPAC name: (4-chloro-5-iodopyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)silane. InChIKey: VWCPSKWKPNDOIH-UHFFFAOYSA-N.
| Molecular formula | C16H24ClIN2Si |
|---|---|
| Molecular weight | 434.82 g/mol |
| IUPAC name | (4-chloro-5-iodopyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)silane |
| InChIKey | VWCPSKWKPNDOIH-UHFFFAOYSA-N |
| SMILES | CC(C)[Si](C(C)C)(C(C)C)N1C=CC2=C(C(=CN=C21)I)Cl |
Computed by PubChem (NCBI)