CAS 1015758-24-3 is the registry number for Lactose 6’-Sulfate. Offered by: TRC. Available pack sizes: 75mg.
Beta-D-Galp6S-(1->4)-beta-D-Glcp is a glycosylglucose derivative that consists of beta-D-glucose having a 6-sulfated beta-D-galactosyl residue attached at position 4. It has a role as an epitope. It is an oligosaccharide sulfate and a glycosylglucose derivative.
Source: ChEBI
| Molecular formula | C12H22O14S |
|---|---|
| Molecular weight | 422.36 g/mol |
| IUPAC name | [(2R,3R,4S,5R,6S)-3,4,5-trihydroxy-6-[(2R,3S,4R,5R,6R)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxyoxan-2-yl]methyl hydrogen sulfate |
| InChIKey | NEVLAHFUHIDOLO-DCSYEGIMSA-N |
| SMILES | C([C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)O)O)O)O[C@H]2[C@@H]([C@H]([C@H]([C@H](O2)COS(=O)(=O)O)O)O)O)O |
Computed by PubChem (NCBI)