CAS 101579-12-8 is the registry number for 5,6-bis(4-bromophenyl)pyrazine-2,3-dicarbonitrile5,6-bis(4-bromophenyl)pyrazine-2,3-dicarbonitrile, >98% (HPLC). Offered by: Lumtec. Available pack sizes: On request.
5,6-bis(4-bromophenyl)pyrazine-2,3-dicarbonitrile (CAS 101579-12-8) is a chemical compound with the molecular formula C18H8Br2N4 and a molecular weight of 440.1 g/mol. IUPAC name: 5,6-bis(4-bromophenyl)pyrazine-2,3-dicarbonitrile. InChIKey: LSKHCUUIHXQQLK-UHFFFAOYSA-N.
| Molecular formula | C18H8Br2N4 |
|---|---|
| Molecular weight | 440.1 g/mol |
| IUPAC name | 5,6-bis(4-bromophenyl)pyrazine-2,3-dicarbonitrile |
| InChIKey | LSKHCUUIHXQQLK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC(=C(N=C2C3=CC=C(C=C3)Br)C#N)C#N)Br |
Computed by PubChem (NCBI)