Products 1015856-43-5
CAS 1015856-43-5 is the registry number for tert-Butyl 2-(dibromomethyl)quinoline-4-carboxylate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
Tert-butyl 2-(dibromomethyl)quinoline-4-carboxylate (CAS 1015856-43-5) is a chemical compound with the molecular formula C15H15Br2NO2 and a molecular weight of 401.09 g/mol. IUPAC name: tert-butyl 2-(dibromomethyl)quinoline-4-carboxylate. InChIKey: KLABLVZXQMBVGN-UHFFFAOYSA-N.
| Molecular formula | C15H15Br2NO2 |
|---|---|
| Molecular weight | 401.09 g/mol |
| IUPAC name | tert-butyl 2-(dibromomethyl)quinoline-4-carboxylate |
| InChIKey | KLABLVZXQMBVGN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC(=NC2=CC=CC=C21)C(Br)Br |
Computed by PubChem (NCBI)