CAS 1987244-68-7 is the registry number for (1,3-Benzodioxol-5-ylmethyl)(3-bromobenzyl)amine hydrobromide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
N-(1,3-benzodioxol-5-ylmethyl)-1-(3-bromophenyl)methanamine;hydrobromide (CAS 1987244-68-7) is a chemical compound with the molecular formula C15H15Br2NO2 and a molecular weight of 401.09 g/mol. IUPAC name: N-(1,3-benzodioxol-5-ylmethyl)-1-(3-bromophenyl)methanamine;hydrobromide. InChIKey: XVKDFBAFNROQNU-UHFFFAOYSA-N.
| Molecular formula | C15H15Br2NO2 |
|---|---|
| Molecular weight | 401.09 g/mol |
| IUPAC name | N-(1,3-benzodioxol-5-ylmethyl)-1-(3-bromophenyl)methanamine;hydrobromide |
| InChIKey | XVKDFBAFNROQNU-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)CNCC3=CC(=CC=C3)Br.Br |
Computed by PubChem (NCBI)