CAS 1015869-64-3 is the registry number for 5-Amino-N-(4-fluorophenyl)-1-phenyl-1H-pyrazole-4-carboxamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-amino-N-(4-fluorophenyl)-1-phenylpyrazole-4-carboxamide (CAS 1015869-64-3) is a chemical compound with the molecular formula C16H13FN4O and a molecular weight of 296.30 g/mol. IUPAC name: 5-amino-N-(4-fluorophenyl)-1-phenylpyrazole-4-carboxamide. InChIKey: OMPNJIBISHGCOZ-UHFFFAOYSA-N.
| Molecular formula | C16H13FN4O |
|---|---|
| Molecular weight | 296.30 g/mol |
| IUPAC name | 5-amino-N-(4-fluorophenyl)-1-phenylpyrazole-4-carboxamide |
| InChIKey | OMPNJIBISHGCOZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=C(C=N2)C(=O)NC3=CC=C(C=C3)F)N |
Computed by PubChem (NCBI)