Products 1015873-61-6

CAS 1015873-61-6 is the registry number for 1-(4-Fluorophenyl)-5-(1h-pyrrol-1-yl)-1h-pyrazole-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

1-(4-fluorophenyl)-5-pyrrol-1-ylpyrazole-4-carboxylic acid (CAS 1015873-61-6) is a chemical compound with the molecular formula C14H10FN3O2 and a molecular weight of 271.25 g/mol. IUPAC name: 1-(4-fluorophenyl)-5-pyrrol-1-ylpyrazole-4-carboxylic acid. InChIKey: DQTYNXBPLGQSNB-UHFFFAOYSA-N.

Identity
Molecular formulaC14H10FN3O2
Molecular weight271.25 g/mol
IUPAC name1-(4-fluorophenyl)-5-pyrrol-1-ylpyrazole-4-carboxylic acid
InChIKeyDQTYNXBPLGQSNB-UHFFFAOYSA-N
SMILESC1=CN(C=C1)C2=C(C=NN2C3=CC=C(C=C3)F)C(=O)O

Computed by PubChem (NCBI)