CAS 1016-44-0 appears in our catalog under these names: Alpha,O-Dimethyl Serotonin Hydrochloride, >95% (HPLC), 5-Methoxy-alpha-methyltryptamine Hydrochloride (5-MeO-AMT HCl) 1.0 mg/ml in Methanol (as free base), α,O–Dimethyl Serotonin Hydrochloride, 5-Methoxy-3(2-aminopropyl)indole hydrochloride, a,O-Dimethyl Serotonin Hydrochloride, ≥98%, ≥98%. Offered by: TRC, LoGiCal, GLPBio, Biosynth, Chemat. Available pack sizes: 2,5g, 250mg, 1ml, 50mg, 5g, 10g, 25g.
1-(5-methoxy-1H-indol-3-yl)propan-2-amine;hydrochloride (CAS 1016-44-0) is a chemical compound with the molecular formula C12H17ClN2O and a molecular weight of 240.73 g/mol. IUPAC name: 1-(5-methoxy-1H-indol-3-yl)propan-2-amine;hydrochloride. InChIKey: AOGUIGSAWNQBBG-UHFFFAOYSA-N.
| Molecular formula | C12H17ClN2O |
|---|---|
| Molecular weight | 240.73 g/mol |
| IUPAC name | 1-(5-methoxy-1H-indol-3-yl)propan-2-amine;hydrochloride |
| InChIKey | AOGUIGSAWNQBBG-UHFFFAOYSA-N |
| SMILES | CC(CC1=CNC2=C1C=C(C=C2)OC)N.Cl |
Computed by PubChem (NCBI)