CAS 101622-53-1 appears in our catalog under these names: 2-Chloro-9-methyl-6-(benzylamino)purine, CDK2-IN-13, 98%, CDK2–IN–13, CDK2-IN-13 99%, CDK2-IN-13, 98.20%. Offered by: TRC, AmBeed, GLPBio, MedChemExpress, Fluorochem. Available pack sizes: 250mg, 25mg, 5g, 10g, 1g, 100mg, 50mg, 100 mg.
N-benzyl-2-chloro-9-methylpurin-6-amine (CAS 101622-53-1) is a chemical compound with the molecular formula C13H12ClN5 and a molecular weight of 273.72 g/mol. IUPAC name: N-benzyl-2-chloro-9-methylpurin-6-amine. InChIKey: QNKNBVBQFILDGJ-UHFFFAOYSA-N.
| Molecular formula | C13H12ClN5 |
|---|---|
| Molecular weight | 273.72 g/mol |
| IUPAC name | N-benzyl-2-chloro-9-methylpurin-6-amine |
| InChIKey | QNKNBVBQFILDGJ-UHFFFAOYSA-N |
| SMILES | CN1C=NC2=C(N=C(N=C21)Cl)NCC3=CC=CC=C3 |
Computed by PubChem (NCBI)