CAS 1016259-87-2 is the registry number for tert-Butyl (3S,4S)-3-amino-4-(hydroxymethyl)pyrrolidine-1-carboxylate, 97%. Offered by: AmBeed, Fluorochem, Chemat. Available pack sizes: 5g, 1g, 100mg, 250mg, 500mg.
Tert-butyl (3S,4S)-3-amino-4-(hydroxymethyl)pyrrolidine-1-carboxylate (CAS 1016259-87-2) is a chemical compound with the molecular formula C10H20N2O3 and a molecular weight of 216.28 g/mol. IUPAC name: tert-butyl (3S,4S)-3-amino-4-(hydroxymethyl)pyrrolidine-1-carboxylate. InChIKey: ZJLQOBHAWWWERW-HTQZYQBOSA-N.
| Molecular formula | C10H20N2O3 |
|---|---|
| Molecular weight | 216.28 g/mol |
| IUPAC name | tert-butyl (3S,4S)-3-amino-4-(hydroxymethyl)pyrrolidine-1-carboxylate |
| InChIKey | ZJLQOBHAWWWERW-HTQZYQBOSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]([C@@H](C1)N)CO |
Computed by PubChem (NCBI)