Products 101626-66-8
CAS 101626-66-8 appears in our catalog under these names: Dobutamine tartrate, Dobutamine (tartrate). Offered by: TargetMol, MedChemExpress. Available pack sizes: 25mg, 50mg, 100mg, Get quote.
(2S,3S)-2,3-dihydroxybutanedioic acid;4-[2-[4-(4-hydroxyphenyl)butan-2-ylamino]ethyl]benzene-1,2-diol (CAS 101626-66-8) is a chemical compound with the molecular formula C22H29NO9 and a molecular weight of 451.5 g/mol. IUPAC name: (2S,3S)-2,3-dihydroxybutanedioic acid;4-[2-[4-(4-hydroxyphenyl)butan-2-ylamino]ethyl]benzene-1,2-diol. InChIKey: WZIUXGZIVZDXIG-WUUYCOTASA-N.
| Molecular formula | C22H29NO9 |
|---|---|
| Molecular weight | 451.5 g/mol |
| IUPAC name | (2S,3S)-2,3-dihydroxybutanedioic acid;4-[2-[4-(4-hydroxyphenyl)butan-2-ylamino]ethyl]benzene-1,2-diol |
| InChIKey | WZIUXGZIVZDXIG-WUUYCOTASA-N |
| SMILES | CC(CCC1=CC=C(C=C1)O)NCCC2=CC(=C(C=C2)O)O.[C@H]([C@@H](C(=O)O)O)(C(=O)O)O |
Computed by PubChem (NCBI)