CAS 1016316-14-5 is the registry number for 5-Bromo-6-methylquinolin-2(1H)-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-bromo-6-methyl-1H-quinolin-2-one (CAS 1016316-14-5) is a chemical compound with the molecular formula C10H8BrNO and a molecular weight of 238.08 g/mol. IUPAC name: 5-bromo-6-methyl-1H-quinolin-2-one. InChIKey: NBROUSPITUKLCY-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO |
|---|---|
| Molecular weight | 238.08 g/mol |
| IUPAC name | 5-bromo-6-methyl-1H-quinolin-2-one |
| InChIKey | NBROUSPITUKLCY-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=C1)NC(=O)C=C2)Br |
Computed by PubChem (NCBI)