CAS 1016494-95-3 appears in our catalog under these names: 1-(4-Fluorophenyl)-3,3-dimethylbutan-1-amine, 95%, 1-(4-Fluorophenyl)-3,3-dimethylbutan-1-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
1-(4-fluorophenyl)-3,3-dimethylbutan-1-amine (CAS 1016494-95-3) is a chemical compound with the molecular formula C12H18FN and a molecular weight of 195.28 g/mol. IUPAC name: 1-(4-fluorophenyl)-3,3-dimethylbutan-1-amine. InChIKey: MKWUIZGKZIUVGC-UHFFFAOYSA-N.
| Molecular formula | C12H18FN |
|---|---|
| Molecular weight | 195.28 g/mol |
| IUPAC name | 1-(4-fluorophenyl)-3,3-dimethylbutan-1-amine |
| InChIKey | MKWUIZGKZIUVGC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)CC(C1=CC=C(C=C1)F)N |
Computed by PubChem (NCBI)