Products 1016512-66-5
CAS 1016512-66-5 is the registry number for (3-Aminophenyl)-N-(3,4-dimethoxyphenyl)formamide. Offered by: Biosynth. Available pack sizes: 2000mg, 1000mg, 5000mg, 10000mg.
3-amino-N-(3,4-dimethoxyphenyl)benzamide (CAS 1016512-66-5) is a chemical compound with the molecular formula C15H16N2O3 and a molecular weight of 272.30 g/mol. IUPAC name: 3-amino-N-(3,4-dimethoxyphenyl)benzamide. InChIKey: GTKFTKPJXGZWIW-UHFFFAOYSA-N.
| Molecular formula | C15H16N2O3 |
|---|---|
| Molecular weight | 272.30 g/mol |
| IUPAC name | 3-amino-N-(3,4-dimethoxyphenyl)benzamide |
| InChIKey | GTKFTKPJXGZWIW-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)NC(=O)C2=CC(=CC=C2)N)OC |
Computed by PubChem (NCBI)