CAS 1386087-61-1 is the registry number for Methyl 2-acetyl-2,3,4,5-tetrahydro-1h-pyrido[4,3-b]indole-8-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Methyl 2-acetyl-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylate (CAS 1386087-61-1) is a chemical compound with the molecular formula C15H16N2O3 and a molecular weight of 272.30 g/mol. IUPAC name: methyl 2-acetyl-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylate. InChIKey: MTPGAZGRXOBPBH-UHFFFAOYSA-N.
| Molecular formula | C15H16N2O3 |
|---|---|
| Molecular weight | 272.30 g/mol |
| IUPAC name | methyl 2-acetyl-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylate |
| InChIKey | MTPGAZGRXOBPBH-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CCC2=C(C1)C3=C(N2)C=CC(=C3)C(=O)OC |
Computed by PubChem (NCBI)