CAS 1016534-75-0 is the registry number for 5-(5-Bromo-2-furyl)-1h-1,2,4-triazol-3-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
5-(5-bromofuran-2-yl)-1H-1,2,4-triazol-3-amine (CAS 1016534-75-0) is a chemical compound with the molecular formula C6H5BrN4O and a molecular weight of 229.03 g/mol. IUPAC name: 5-(5-bromofuran-2-yl)-1H-1,2,4-triazol-3-amine. InChIKey: KUUMVHBGQUCWPT-UHFFFAOYSA-N.
| Molecular formula | C6H5BrN4O |
|---|---|
| Molecular weight | 229.03 g/mol |
| IUPAC name | 5-(5-bromofuran-2-yl)-1H-1,2,4-triazol-3-amine |
| InChIKey | KUUMVHBGQUCWPT-UHFFFAOYSA-N |
| SMILES | C1=C(OC(=C1)Br)C2=NC(=NN2)N |
Computed by PubChem (NCBI)