CAS 1016543-77-3 appears in our catalog under these names: S516, 98%, S516, S516, 98.03%, 98.03%, S516, 98.03%. Offered by: AmBeed, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 100mg, 2mg, 5mg, 25mg, 50mg, 10mg, 1mg, 10 mg.
[4-(2-amino-1,3-thiazol-4-yl)-2-(1,2,4-triazol-1-yl)phenyl]-(3,4,5-trimethoxyphenyl)methanone (CAS 1016543-77-3) is a chemical compound with the molecular formula C21H19N5O4S and a molecular weight of 437.5 g/mol. IUPAC name: [4-(2-amino-1,3-thiazol-4-yl)-2-(1,2,4-triazol-1-yl)phenyl]-(3,4,5-trimethoxyphenyl)methanone. InChIKey: OJZSPKKXYGZDRQ-UHFFFAOYSA-N.
| Molecular formula | C21H19N5O4S |
|---|---|
| Molecular weight | 437.5 g/mol |
| IUPAC name | [4-(2-amino-1,3-thiazol-4-yl)-2-(1,2,4-triazol-1-yl)phenyl]-(3,4,5-trimethoxyphenyl)methanone |
| InChIKey | OJZSPKKXYGZDRQ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1OC)OC)C(=O)C2=C(C=C(C=C2)C3=CSC(=N3)N)N4C=NC=N4 |
Computed by PubChem (NCBI)