CAS 1016683-19-4 appears in our catalog under these names: 3-(5-(4-Methanesulfonylphenyl)-1,3-oxazol-2-yl)propanoic acid, 95%, 3-(5-(4-Methanesulfonylphenyl)-1,3-oxazol-2-yl)propanoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
3-[5-(4-methylsulfonylphenyl)-1,3-oxazol-2-yl]propanoic acid (CAS 1016683-19-4) is a chemical compound with the molecular formula C13H13NO5S and a molecular weight of 295.31 g/mol. IUPAC name: 3-[5-(4-methylsulfonylphenyl)-1,3-oxazol-2-yl]propanoic acid. InChIKey: RYLHBCGFCSGYFM-UHFFFAOYSA-N.
| Molecular formula | C13H13NO5S |
|---|---|
| Molecular weight | 295.31 g/mol |
| IUPAC name | 3-[5-(4-methylsulfonylphenyl)-1,3-oxazol-2-yl]propanoic acid |
| InChIKey | RYLHBCGFCSGYFM-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC=C(C=C1)C2=CN=C(O2)CCC(=O)O |
Computed by PubChem (NCBI)