Products 1016696-45-9
CAS 1016696-45-9 appears in our catalog under these names: 5-(2-Bromo-5-fluorophenyl)-1,3,4-oxadiazol-2-amine, 95%, 5-(2-Bromo-5-fluorophenyl)-1,3,4-oxadiazol-2-amine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
5-(2-bromo-5-fluorophenyl)-1,3,4-oxadiazol-2-amine (CAS 1016696-45-9) is a chemical compound with the molecular formula C8H5BrFN3O and a molecular weight of 258.05 g/mol. IUPAC name: 5-(2-bromo-5-fluorophenyl)-1,3,4-oxadiazol-2-amine. InChIKey: PZYMMPYPEJEXDP-UHFFFAOYSA-N.
| Molecular formula | C8H5BrFN3O |
|---|---|
| Molecular weight | 258.05 g/mol |
| IUPAC name | 5-(2-bromo-5-fluorophenyl)-1,3,4-oxadiazol-2-amine |
| InChIKey | PZYMMPYPEJEXDP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)C2=NN=C(O2)N)Br |
Computed by PubChem (NCBI)