CAS 1016704-20-3 appears in our catalog under these names: 3-Fluoro-4-methanesulfonamidobenzene-1-sulfonyl chloride, 3-Fluoro-4-methanesulfonamidobenzene-1-sulfonyl chloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 1g.
3-fluoro-4-(methanesulfonamido)benzenesulfonyl chloride (CAS 1016704-20-3) is a chemical compound with the molecular formula C7H7ClFNO4S2 and a molecular weight of 287.7 g/mol. IUPAC name: 3-fluoro-4-(methanesulfonamido)benzenesulfonyl chloride. InChIKey: VBJPDRCPOAOCJQ-UHFFFAOYSA-N.
| Molecular formula | C7H7ClFNO4S2 |
|---|---|
| Molecular weight | 287.7 g/mol |
| IUPAC name | 3-fluoro-4-(methanesulfonamido)benzenesulfonyl chloride |
| InChIKey | VBJPDRCPOAOCJQ-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)NC1=C(C=C(C=C1)S(=O)(=O)Cl)F |
Computed by PubChem (NCBI)