Products 1016731-93-3

CAS 1016731-93-3 is the registry number for 3-(4-Benzylpiperazin-1-yl)-n'-hydroxypropanimidamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

3-(4-benzylpiperazin-1-yl)-N'-hydroxypropanimidamide (CAS 1016731-93-3) is a chemical compound with the molecular formula C14H22N4O and a molecular weight of 262.35 g/mol. IUPAC name: 3-(4-benzylpiperazin-1-yl)-N'-hydroxypropanimidamide. InChIKey: PQYIKYZLHCEQIS-UHFFFAOYSA-N.

Identity
Molecular formulaC14H22N4O
Molecular weight262.35 g/mol
IUPAC name3-(4-benzylpiperazin-1-yl)-N'-hydroxypropanimidamide
InChIKeyPQYIKYZLHCEQIS-UHFFFAOYSA-N
SMILESC1CN(CCN1CC/C(=N/O)/N)CC2=CC=CC=C2

Computed by PubChem (NCBI)