Products 1016760-03-4

CAS 1016760-03-4 is the registry number for 4-(Chlorosulfonyl)-5-methylfuran-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

4-chlorosulfonyl-5-methylfuran-2-carboxylic acid (CAS 1016760-03-4) is a chemical compound with the molecular formula C6H5ClO5S and a molecular weight of 224.62 g/mol. IUPAC name: 4-chlorosulfonyl-5-methylfuran-2-carboxylic acid. InChIKey: QRSZZLROOTWVDV-UHFFFAOYSA-N.

Identity
Molecular formulaC6H5ClO5S
Molecular weight224.62 g/mol
IUPAC name4-chlorosulfonyl-5-methylfuran-2-carboxylic acid
InChIKeyQRSZZLROOTWVDV-UHFFFAOYSA-N
SMILESCC1=C(C=C(O1)C(=O)O)S(=O)(=O)Cl

Computed by PubChem (NCBI)