CAS 1016773-90-2 appears in our catalog under these names: 1-(4-Bromo-2-fluorophenyl)piperidin-2-one, 1-(4-Bromo-2-fluorophenyl)piperidin-2-one, 95%, 1-(4-Bromo-2-fluorophenyl)piperidin-2-one 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 100mg, 1g, 5g, 50mg, 250mg.
1-(4-bromo-2-fluorophenyl)piperidin-2-one (CAS 1016773-90-2) is a chemical compound with the molecular formula C11H11BrFNO and a molecular weight of 272.11 g/mol. IUPAC name: 1-(4-bromo-2-fluorophenyl)piperidin-2-one. InChIKey: FAFPGXXEFPBHJX-UHFFFAOYSA-N.
| Molecular formula | C11H11BrFNO |
|---|---|
| Molecular weight | 272.11 g/mol |
| IUPAC name | 1-(4-bromo-2-fluorophenyl)piperidin-2-one |
| InChIKey | FAFPGXXEFPBHJX-UHFFFAOYSA-N |
| SMILES | C1CCN(C(=O)C1)C2=C(C=C(C=C2)Br)F |
Computed by PubChem (NCBI)