CAS 1016779-71-7 appears in our catalog under these names: 2-Bromo-N-(1,1-dioxidotetrahydrothiophen-3-yl)-3-methylbutanamide, 95%, 2-​Bromo-​3-​methyl-​N-​(tetrahydro-​1,​1-​dioxido-​3-​thienyl)​-butanamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
2-bromo-N-(1,1-dioxothiolan-3-yl)-3-methylbutanamide (CAS 1016779-71-7) is a chemical compound with the molecular formula C9H16BrNO3S and a molecular weight of 298.20 g/mol. IUPAC name: 2-bromo-N-(1,1-dioxothiolan-3-yl)-3-methylbutanamide. InChIKey: XBNZHZZZSRVSTC-UHFFFAOYSA-N.
| Molecular formula | C9H16BrNO3S |
|---|---|
| Molecular weight | 298.20 g/mol |
| IUPAC name | 2-bromo-N-(1,1-dioxothiolan-3-yl)-3-methylbutanamide |
| InChIKey | XBNZHZZZSRVSTC-UHFFFAOYSA-N |
| SMILES | CC(C)C(C(=O)NC1CCS(=O)(=O)C1)Br |
Computed by PubChem (NCBI)