Products 10168-58-8
CAS 10168-58-8 appears in our catalog under these names: 4-Bromo-3-methylpyridine 1-oxide, 97%, 4-Bromo-3-methylpyridine 1-oxide, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 5g, 25g.
4-bromo-3-methyl-1-oxidopyridin-1-ium (CAS 10168-58-8) is a chemical compound with the molecular formula C6H6BrNO and a molecular weight of 188.02 g/mol. IUPAC name: 4-bromo-3-methyl-1-oxidopyridin-1-ium. InChIKey: KHPKSGWJJIGDTI-UHFFFAOYSA-N.
| Molecular formula | C6H6BrNO |
|---|---|
| Molecular weight | 188.02 g/mol |
| IUPAC name | 4-bromo-3-methyl-1-oxidopyridin-1-ium |
| InChIKey | KHPKSGWJJIGDTI-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C[N+](=C1)[O-])Br |
Computed by PubChem (NCBI)