Products 1016824-15-9
CAS 1016824-15-9 appears in our catalog under these names: 2-(2-Amino-5-methylphenoxy)-n,n-dimethylacetamide, 95%, 2-(2-Amino-5-methylphenoxy)-N,N-dimethylacetamide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g, 2,5g.
2-(2-amino-5-methylphenoxy)-N,N-dimethylacetamide (CAS 1016824-15-9) is a chemical compound with the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. IUPAC name: 2-(2-amino-5-methylphenoxy)-N,N-dimethylacetamide. InChIKey: BAMDTUSMNSBAHT-UHFFFAOYSA-N.
| Molecular formula | C11H16N2O2 |
|---|---|
| Molecular weight | 208.26 g/mol |
| IUPAC name | 2-(2-amino-5-methylphenoxy)-N,N-dimethylacetamide |
| InChIKey | BAMDTUSMNSBAHT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)N)OCC(=O)N(C)C |
Computed by PubChem (NCBI)