CAS 1016867-66-5 appears in our catalog under these names: Methyl 3-chloro-1,1-dioxo-1,2-benzothiazole-6-carboxylate, 95%, Methyl 3-chloro-1,1-dioxo-1,2-benzothiazole-6-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
Methyl 3-chloro-1,1-dioxo-1,2-benzothiazole-6-carboxylate (CAS 1016867-66-5) is a chemical compound with the molecular formula C9H6ClNO4S and a molecular weight of 259.67 g/mol. IUPAC name: methyl 3-chloro-1,1-dioxo-1,2-benzothiazole-6-carboxylate. InChIKey: IDNKWLBRVDNHAV-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO4S |
|---|---|
| Molecular weight | 259.67 g/mol |
| IUPAC name | methyl 3-chloro-1,1-dioxo-1,2-benzothiazole-6-carboxylate |
| InChIKey | IDNKWLBRVDNHAV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)C(=NS2(=O)=O)Cl |
Computed by PubChem (NCBI)