CAS 1017-60-3 appears in our catalog under these names: Di–p–tolylphosphine, Bis(4-methylphenyl)phosphine, 95%,RG, 95%,RG. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 250mg, 100mg.
Bis(4-methylphenyl)phosphane (CAS 1017-60-3) is a chemical compound with the molecular formula C14H15P and a molecular weight of 214.24 g/mol. IUPAC name: bis(4-methylphenyl)phosphane. InChIKey: RRSCGNXXNRAXJC-UHFFFAOYSA-N.
| Molecular formula | C14H15P |
|---|---|
| Molecular weight | 214.24 g/mol |
| IUPAC name | bis(4-methylphenyl)phosphane |
| InChIKey | RRSCGNXXNRAXJC-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)PC2=CC=C(C=C2)C |
Computed by PubChem (NCBI)