CAS 1017-88-5 appears in our catalog under these names: Dimethyldiphenylphosphonium iodide, Dimethyldiphenylphosphonium iodide 95%, Dimethyldiphenylphosphonium iodide, 95%, 95%, Dimethyldiphenylphosphonium iodide, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g.
Dimethyl(diphenyl)phosphanium iodide (CAS 1017-88-5) is a chemical compound with the molecular formula C14H16IP and a molecular weight of 342.15 g/mol. IUPAC name: dimethyl(diphenyl)phosphanium iodide. InChIKey: MGLUUYLPGOWCNW-UHFFFAOYSA-M.
| Molecular formula | C14H16IP |
|---|---|
| Molecular weight | 342.15 g/mol |
| IUPAC name | dimethyl(diphenyl)phosphanium iodide |
| InChIKey | MGLUUYLPGOWCNW-UHFFFAOYSA-M |
| SMILES | C[P+](C)(C1=CC=CC=C1)C2=CC=CC=C2.[I-] |
Computed by PubChem (NCBI)