Products 1017082-78-8
CAS 1017082-78-8 appears in our catalog under these names: 4-Methyl-3-benzyloxybenzoic acid methyl ester, 95%, Methyl 3-(benzyloxy)-4-methylbenzoate, 95+%, 4-Methyl-3-benzyloxybenzoic acid methyl ester, ≥95%, ≥95%, 4-Methyl-3-benzyloxybenzoic acid methyl ester, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.
Methyl 4-methyl-3-phenylmethoxybenzoate (CAS 1017082-78-8) is a chemical compound with the molecular formula C16H16O3 and a molecular weight of 256.30 g/mol. IUPAC name: methyl 4-methyl-3-phenylmethoxybenzoate. InChIKey: NIFKZZQLVQCGIA-UHFFFAOYSA-N.
| Molecular formula | C16H16O3 |
|---|---|
| Molecular weight | 256.30 g/mol |
| IUPAC name | methyl 4-methyl-3-phenylmethoxybenzoate |
| InChIKey | NIFKZZQLVQCGIA-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)OC)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)