CAS 1017082-94-8 is the registry number for 3'-(Tetrafluoroethoxy)-beta-methyl-beta-nitrostyrene. Offered by: Biosynth. Available pack sizes: 10mg, 5mg, 25mg.
1-[(Z)-2-nitroprop-1-enyl]-3-(1,1,2,2-tetrafluoroethoxy)benzene (CAS 1017082-94-8) is a chemical compound with the molecular formula C11H9F4NO3 and a molecular weight of 279.19 g/mol. IUPAC name: 1-[(Z)-2-nitroprop-1-enyl]-3-(1,1,2,2-tetrafluoroethoxy)benzene. InChIKey: OFKYDXJNRZQVPV-ALCCZGGFSA-N.
| Molecular formula | C11H9F4NO3 |
|---|---|
| Molecular weight | 279.19 g/mol |
| IUPAC name | 1-[(Z)-2-nitroprop-1-enyl]-3-(1,1,2,2-tetrafluoroethoxy)benzene |
| InChIKey | OFKYDXJNRZQVPV-ALCCZGGFSA-N |
| SMILES | C/C(=C/C1=CC(=CC=C1)OC(C(F)F)(F)F)/[N+](=O)[O-] |
Computed by PubChem (NCBI)