Products 1017242-94-2
CAS 1017242-94-2 is the registry number for Kadsuphilin J. Offered by: MedChemExpress. Available pack sizes: 10 mg, 1 mg, 5 mg.
5-[(2R,3S,4R)-4-hydroxy-4-(3-hydroxy-4,5-dimethoxyphenyl)-2,3-dimethylbutyl]-2,3-dimethoxyphenol (CAS 1017242-94-2) is a chemical compound with the molecular formula C22H30O7 and a molecular weight of 406.5 g/mol. IUPAC name: 5-[(2R,3S,4R)-4-hydroxy-4-(3-hydroxy-4,5-dimethoxyphenyl)-2,3-dimethylbutyl]-2,3-dimethoxyphenol. InChIKey: SYAQUKRBBRLVBT-MTJIALIYSA-N.
| Molecular formula | C22H30O7 |
|---|---|
| Molecular weight | 406.5 g/mol |
| IUPAC name | 5-[(2R,3S,4R)-4-hydroxy-4-(3-hydroxy-4,5-dimethoxyphenyl)-2,3-dimethylbutyl]-2,3-dimethoxyphenol |
| InChIKey | SYAQUKRBBRLVBT-MTJIALIYSA-N |
| SMILES | C[C@H](CC1=CC(=C(C(=C1)OC)OC)O)[C@H](C)[C@H](C2=CC(=C(C(=C2)OC)OC)O)O |
Computed by PubChem (NCBI)
Synonyms:
Kadsuphilin J, orb1942771