Products 1017246-65-9
CAS 1017246-65-9 is the registry number for 4-(4-Bromophenyl)-2,5-dihydro-1H-pyrrol-2-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-(4-bromophenyl)-1,2-dihydropyrrol-5-one (CAS 1017246-65-9) is a chemical compound with the molecular formula C10H8BrNO and a molecular weight of 238.08 g/mol. IUPAC name: 3-(4-bromophenyl)-1,2-dihydropyrrol-5-one. InChIKey: BVBVWIADDJOSKH-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO |
|---|---|
| Molecular weight | 238.08 g/mol |
| IUPAC name | 3-(4-bromophenyl)-1,2-dihydropyrrol-5-one |
| InChIKey | BVBVWIADDJOSKH-UHFFFAOYSA-N |
| SMILES | C1C(=CC(=O)N1)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)