CAS 1017264-48-0 appears in our catalog under these names: 5-Bromofuran-2-sulfonamide, 95%, 5-Bromofuran-2-sulfonamide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,05g, 0,1g, 0,25g, 0,5g.
5-bromofuran-2-sulfonamide (CAS 1017264-48-0) is a chemical compound with the molecular formula C4H4BrNO3S and a molecular weight of 226.05 g/mol. IUPAC name: 5-bromofuran-2-sulfonamide. InChIKey: XYTHDEPHDIPOCJ-UHFFFAOYSA-N.
| Molecular formula | C4H4BrNO3S |
|---|---|
| Molecular weight | 226.05 g/mol |
| IUPAC name | 5-bromofuran-2-sulfonamide |
| InChIKey | XYTHDEPHDIPOCJ-UHFFFAOYSA-N |
| SMILES | C1=C(OC(=C1)Br)S(=O)(=O)N |
Computed by PubChem (NCBI)