CAS 1017396-25-6 appears in our catalog under these names: 2-(3-Chlorophenyl)-5,5-dimethylmorpholine, 95%, 2-(3-Chlorophenyl)-5,5-dimethylmorpholine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 50mg, 0,5g.
2-(3-chlorophenyl)-5,5-dimethylmorpholine (CAS 1017396-25-6) is a chemical compound with the molecular formula C12H16ClNO and a molecular weight of 225.71 g/mol. IUPAC name: 2-(3-chlorophenyl)-5,5-dimethylmorpholine. InChIKey: OFJQFAKNSFCCTE-UHFFFAOYSA-N.
| Molecular formula | C12H16ClNO |
|---|---|
| Molecular weight | 225.71 g/mol |
| IUPAC name | 2-(3-chlorophenyl)-5,5-dimethylmorpholine |
| InChIKey | OFJQFAKNSFCCTE-UHFFFAOYSA-N |
| SMILES | CC1(COC(CN1)C2=CC(=CC=C2)Cl)C |
Computed by PubChem (NCBI)