CAS 1017396-60-9 appears in our catalog under these names: 3-(3-Chlorophenyl)-morpholine hydrochloride, 97%, 97%, 3-(3-Chlorophenyl)morpholine, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 500mg, 1g.
3-(3-chlorophenyl)morpholine (CAS 1017396-60-9) is a chemical compound with the molecular formula C10H12ClNO and a molecular weight of 197.66 g/mol. IUPAC name: 3-(3-chlorophenyl)morpholine. InChIKey: BVVLTFIYZDQMAU-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO |
|---|---|
| Molecular weight | 197.66 g/mol |
| IUPAC name | 3-(3-chlorophenyl)morpholine |
| InChIKey | BVVLTFIYZDQMAU-UHFFFAOYSA-N |
| SMILES | C1COCC(N1)C2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)