CAS 1017400-73-5 is the registry number for 2-Isopropylisoindolin-5-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-propan-2-yl-1,3-dihydroisoindol-5-amine (CAS 1017400-73-5) is a chemical compound with the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. IUPAC name: 2-propan-2-yl-1,3-dihydroisoindol-5-amine. InChIKey: HDTCCGDLBZOGLK-UHFFFAOYSA-N.
| Molecular formula | C11H16N2 |
|---|---|
| Molecular weight | 176.26 g/mol |
| IUPAC name | 2-propan-2-yl-1,3-dihydroisoindol-5-amine |
| InChIKey | HDTCCGDLBZOGLK-UHFFFAOYSA-N |
| SMILES | CC(C)N1CC2=C(C1)C=C(C=C2)N |
Computed by PubChem (NCBI)