CAS 1017421-54-3 is the registry number for [2-(([4-(Acetylamino)phenyl]sulfonyl)amino)-1,3-thiazol-4-yl]acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 25g, 5g.
2-[2-[(4-acetamidophenyl)sulfonylamino]-1,3-thiazol-4-yl]acetic acid (CAS 1017421-54-3) is a chemical compound with the molecular formula C13H13N3O5S2 and a molecular weight of 355.4 g/mol. IUPAC name: 2-[2-[(4-acetamidophenyl)sulfonylamino]-1,3-thiazol-4-yl]acetic acid. InChIKey: RTTDXWGPFHEOHK-UHFFFAOYSA-N.
| Molecular formula | C13H13N3O5S2 |
|---|---|
| Molecular weight | 355.4 g/mol |
| IUPAC name | 2-[2-[(4-acetamidophenyl)sulfonylamino]-1,3-thiazol-4-yl]acetic acid |
| InChIKey | RTTDXWGPFHEOHK-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)S(=O)(=O)NC2=NC(=CS2)CC(=O)O |
Computed by PubChem (NCBI)