CAS 1017471-25-8 is the registry number for 1-(1-(4-Fluorophenyl)-5-methyl-1H-1,2,3-triazol-4-yl)ethan-1-one, 95%. Offered by: AmBeed. Available pack sizes: 5g.
1-[1-(4-fluorophenyl)-5-methyltriazol-4-yl]ethanone (CAS 1017471-25-8) is a chemical compound with the molecular formula C11H10FN3O and a molecular weight of 219.21 g/mol. IUPAC name: 1-[1-(4-fluorophenyl)-5-methyltriazol-4-yl]ethanone. InChIKey: KOGFLGOVBKEDMF-UHFFFAOYSA-N.
| Molecular formula | C11H10FN3O |
|---|---|
| Molecular weight | 219.21 g/mol |
| IUPAC name | 1-[1-(4-fluorophenyl)-5-methyltriazol-4-yl]ethanone |
| InChIKey | KOGFLGOVBKEDMF-UHFFFAOYSA-N |
| SMILES | CC1=C(N=NN1C2=CC=C(C=C2)F)C(=O)C |
Computed by PubChem (NCBI)