CAS 1017477-72-3 appears in our catalog under these names: 5-Cyclopropyl-1-(3-(trifluoromethyl)phenyl)-1H-1,2,3-triazole-4-carboxylic acid, 95%, 5-Cyclopropyl-1-(3-(trifluoromethyl)phenyl)-1H-1,2,3-triazole-4-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
5-cyclopropyl-1-[3-(trifluoromethyl)phenyl]triazole-4-carboxylic acid (CAS 1017477-72-3) is a chemical compound with the molecular formula C13H10F3N3O2 and a molecular weight of 297.23 g/mol. IUPAC name: 5-cyclopropyl-1-[3-(trifluoromethyl)phenyl]triazole-4-carboxylic acid. InChIKey: CMHWCWFZBTYURY-UHFFFAOYSA-N.
| Molecular formula | C13H10F3N3O2 |
|---|---|
| Molecular weight | 297.23 g/mol |
| IUPAC name | 5-cyclopropyl-1-[3-(trifluoromethyl)phenyl]triazole-4-carboxylic acid |
| InChIKey | CMHWCWFZBTYURY-UHFFFAOYSA-N |
| SMILES | C1CC1C2=C(N=NN2C3=CC=CC(=C3)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)