Products 101749-77-3

CAS 101749-77-3 appears in our catalog under these names: 4-Methoxydiphenyliodonium chloride, 95%, 4-Methoxydiphenyliodonium chloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 100mg, 1g, 250mg, 500mg, 1000mg.

Structural formula: {0} (CAS {1})

(4-methoxyphenyl)-phenyliodanium chloride (CAS 101749-77-3) is a chemical compound with the molecular formula C13H12ClIO and a molecular weight of 346.59 g/mol. IUPAC name: (4-methoxyphenyl)-phenyliodanium chloride. InChIKey: HRUVWJYRLABNRM-UHFFFAOYSA-M.

Identity
Molecular formulaC13H12ClIO
Molecular weight346.59 g/mol
IUPAC name(4-methoxyphenyl)-phenyliodanium chloride
InChIKeyHRUVWJYRLABNRM-UHFFFAOYSA-M
SMILESCOC1=CC=C(C=C1)[I+]C2=CC=CC=C2.[Cl-]

Computed by PubChem (NCBI)