CAS 101749-77-3 appears in our catalog under these names: 4-Methoxydiphenyliodonium chloride, 95%, 4-Methoxydiphenyliodonium chloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 100mg, 1g, 250mg, 500mg, 1000mg.
(4-methoxyphenyl)-phenyliodanium chloride (CAS 101749-77-3) is a chemical compound with the molecular formula C13H12ClIO and a molecular weight of 346.59 g/mol. IUPAC name: (4-methoxyphenyl)-phenyliodanium chloride. InChIKey: HRUVWJYRLABNRM-UHFFFAOYSA-M.
| Molecular formula | C13H12ClIO |
|---|---|
| Molecular weight | 346.59 g/mol |
| IUPAC name | (4-methoxyphenyl)-phenyliodanium chloride |
| InChIKey | HRUVWJYRLABNRM-UHFFFAOYSA-M |
| SMILES | COC1=CC=C(C=C1)[I+]C2=CC=CC=C2.[Cl-] |
Computed by PubChem (NCBI)