CAS 1017528-43-6 appears in our catalog under these names: 3-(Difluoromethoxy)benzoic acid, sodium salt, 95%, 3-(Difluoromethoxy)benzoic acid, sodium salt, 95%, 95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg.
Sodium 3-(difluoromethoxy)benzoate (CAS 1017528-43-6) is a chemical compound with the molecular formula C8H5F2NaO3 and a molecular weight of 210.11 g/mol. IUPAC name: sodium 3-(difluoromethoxy)benzoate. InChIKey: NOCQWICBWWPQCH-UHFFFAOYSA-M.
| Molecular formula | C8H5F2NaO3 |
|---|---|
| Molecular weight | 210.11 g/mol |
| IUPAC name | sodium 3-(difluoromethoxy)benzoate |
| InChIKey | NOCQWICBWWPQCH-UHFFFAOYSA-M |
| SMILES | C1=CC(=CC(=C1)OC(F)F)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)