Products 1017577-23-9

CAS 1017577-23-9 is the registry number for 2,6-Bis(1-methylethoxy)pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

2,6-di(propan-2-yloxy)pyridine (CAS 1017577-23-9) is a chemical compound with the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. IUPAC name: 2,6-di(propan-2-yloxy)pyridine. InChIKey: JQYBCXNBIFYFBE-UHFFFAOYSA-N.

Identity
Molecular formulaC11H17NO2
Molecular weight195.26 g/mol
IUPAC name2,6-di(propan-2-yloxy)pyridine
InChIKeyJQYBCXNBIFYFBE-UHFFFAOYSA-N
SMILESCC(C)OC1=NC(=CC=C1)OC(C)C

Computed by PubChem (NCBI)